C45H31F3N6 — CID 158369392
2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 158369392) has the molecular formula C45H31F3N6 and a molecular weight of 712.78 g/mol. Its IUPAC name is 2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 158369392 |
| Molecular Formula | C45H31F3N6 |
| Molecular Weight | 712.78 g/mol |
| Exact Mass | 712.26 |
| IUPAC Name | 2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC(c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1)(c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1)C(F)(F)F |
| InChI | InChI=1S/C45H31F3N6/c1-44(45(46,47)48,36-26-22-34(23-27-36)42-51-38(30-14-6-2-7-15-30)49-39(52-42)31-16-8-3-9-17-31)37-28-24-35(25-29-37)43-53-40(32-18-10-4-11-19-32)50-41(54-43)33-20-12-5-13-21-33/h2-29H,1H3 |
| InChIKey | KPHWDSLMEVIBBC-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.78 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |