C16H11F11 — CID 158369663
methane;1-methyl-3,5-bis(trifluoromethyl)benzene;1,2,3,4,5-pentafluorobenzene (PubChem CID 158369663) has the molecular formula C16H11F11 and a molecular weight of 412.24 g/mol. Its IUPAC name is methane;1-methyl-3,5-bis(trifluoromethyl)benzene;1,2,3,4,5-pentafluorobenzene.
| Compound Name | methane;1-methyl-3,5-bis(trifluoromethyl)benzene;1,2,3,4,5-pentafluorobenzene |
|---|---|
| PubChem CID | 158369663 |
| Molecular Formula | C16H11F11 |
| Molecular Weight | 412.24 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | methane;1-methyl-3,5-bis(trifluoromethyl)benzene;1,2,3,4,5-pentafluorobenzene |
| SMILES | C.Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1.Fc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H6F6.C6HF5.CH4/c1-5-2-6(8(10,11)12)4-7(3-5)9(13,14)15;7-2-1-3(8)5(10)6(11)4(2)9;/h2-4H,1H3;1H;1H4 |
| InChIKey | GULMOYCUUHBMSU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.24 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|