About butyl(triethyl)azanium;2H-pyran
butyl(triethyl)azanium;2H-pyran (PubChem CID 158370510) has the molecular formula C15H30NO+
and a molecular weight of 240.41 g/mol. Its IUPAC name is butyl(triethyl)azanium;2H-pyran.
Molecular Properties
| Compound Name | butyl(triethyl)azanium;2H-pyran |
| PubChem CID | 158370510 |
| Molecular Formula | C15H30NO+ |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | butyl(triethyl)azanium;2H-pyran |
| SMILES | C1=CCOC=C1.CCCC[N+](CC)(CC)CC |
| InChI | InChI=1S/C10H24N.C5H6O/c1-5-9-10-11(6-2,7-3)8-4;1-2-4-6-5-3-1/h5-10H2,1-4H3;1-4H,5H2/q+1; |
| InChIKey | GUNZHKHWYKPKFN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl(triethyl)azanium;2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(triethyl)azanium;2H-pyran?
The IUPAC name of butyl(triethyl)azanium;2H-pyran (CID 158370510) is butyl(triethyl)azanium;2H-pyran.
What is the SMILES notation for butyl(triethyl)azanium;2H-pyran?
The canonical SMILES for butyl(triethyl)azanium;2H-pyran is C1=CCOC=C1.CCCC[N+](CC)(CC)CC.
What is the InChIKey of butyl(triethyl)azanium;2H-pyran?
The InChIKey is GUNZHKHWYKPKFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N.C5H6O/c1-5-9-10-11(6-2,7-3)8-4;1-2-4-6-5-3-1/h5-10H2,1-4H3;1-4H,5H2/q+1;.
What are the key properties of butyl(triethyl)azanium;2H-pyran?
butyl(triethyl)azanium;2H-pyran has a molecular weight of 240.41 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(triethyl)azanium;2H-pyran is sourced from PubChem (CID 158370510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).