C25H35ClN2O2 — CID 158371440
4-chloro-N-(2-phenylethyl)butanamide;methane;1-(2-phenylethyl)pyrrolidin-2-one (PubChem CID 158371440) has the molecular formula C25H35ClN2O2 and a molecular weight of 431.02 g/mol. Its IUPAC name is 4-chloro-N-(2-phenylethyl)butanamide;methane;1-(2-phenylethyl)pyrrolidin-2-one.
| Compound Name | 4-chloro-N-(2-phenylethyl)butanamide;methane;1-(2-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 158371440 |
| Molecular Formula | C25H35ClN2O2 |
| Molecular Weight | 431.02 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 4-chloro-N-(2-phenylethyl)butanamide;methane;1-(2-phenylethyl)pyrrolidin-2-one |
| SMILES | C.O=C(CCCCl)NCCc1ccccc1.O=C1CCCN1CCc1ccccc1 |
| InChI | InChI=1S/C12H16ClNO.C12H15NO.CH4/c13-9-4-7-12(15)14-10-8-11-5-2-1-3-6-11;14-12-7-4-9-13(12)10-8-11-5-2-1-3-6-11;/h1-3,5-6H,4,7-10H2,(H,14,15);1-3,5-6H,4,7-10H2;1H4 |
| InChIKey | GUQVJVAXAUNCRX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.02 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|