C16H24O2 — CID 15837165
1,4-dimethoxy-2,3,5-trimethyl-6-(3-methylbut-3-enyl)benzene (PubChem CID 15837165) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1,4-dimethoxy-2,3,5-trimethyl-6-(3-methylbut-3-enyl)benzene.
| Compound Name | 1,4-dimethoxy-2,3,5-trimethyl-6-(3-methylbut-3-enyl)benzene |
|---|---|
| PubChem CID | 15837165 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1,4-dimethoxy-2,3,5-trimethyl-6-(3-methylbut-3-enyl)benzene |
| SMILES | C=C(C)CCc1c(C)c(OC)c(C)c(C)c1OC |
| InChI | InChI=1S/C16H24O2/c1-10(2)8-9-14-13(5)15(17-6)11(3)12(4)16(14)18-7/h1,8-9H2,2-7H3 |
| InChIKey | NXGDVSQGWBOHCA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|