C52H44BBrO6 — CID 158373284
methyl 6-bromonaphthalene-2-carboxylate;methyl 6-[4-(2-phenylethyl)phenyl]naphthalene-2-carboxylate;[4-[(E)-2-phenylethenyl]phenyl]boronic acid (PubChem CID 158373284) has the molecular formula C52H44BBrO6 and a molecular weight of 855.63 g/mol. Its IUPAC name is methyl 6-bromonaphthalene-2-carboxylate;methyl 6-[4-(2-phenylethyl)phenyl]naphthalene-2-carboxylate;[4-[(E)-2-phenylethenyl]phenyl]boronic acid.
| Compound Name | methyl 6-bromonaphthalene-2-carboxylate;methyl 6-[4-(2-phenylethyl)phenyl]naphthalene-2-carboxylate;[4-[(E)-2-phenylethenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 158373284 |
| Molecular Formula | C52H44BBrO6 |
| Molecular Weight | 855.63 g/mol |
| Exact Mass | 854.24 |
| IUPAC Name | methyl 6-bromonaphthalene-2-carboxylate;methyl 6-[4-(2-phenylethyl)phenyl]naphthalene-2-carboxylate;[4-[(E)-2-phenylethenyl]phenyl]boronic acid |
| SMILES | COC(=O)c1ccc2cc(-c3ccc(CCc4ccccc4)cc3)ccc2c1.COC(=O)c1ccc2cc(Br)ccc2c1.OB(O)c1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22O2.C14H13BO2.C12H9BrO2/c1-28-26(27)25-16-15-23-17-22(13-14-24(23)18-25)21-11-9-20(10-12-21)8-7-19-5-3-2-4-6-19;16-15(17)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12;1-15-12(14)10-3-2-9-7-11(13)5-4-8(9)6-10/h2-6,9-18H,7-8H2,1H3;1-11,16-17H;2-7H,1H3/b;7-6+; |
| InChIKey | GUWQCADJHFDSOR-FPCGKXSPSA-N |
| XLogP | 11.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.63 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|