C25H29N5O2S — CID 158374571
4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-2-pyridinyl]-2-methylbut-3-yn-2-ol (PubChem CID 158374571) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is 4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-2-pyridinyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-2-pyridinyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 158374571 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-2-pyridinyl]-2-methylbut-3-yn-2-ol |
| SMILES | CN1CCC(c2ncc(-c3cnc(N)c(OCc4ccnc(C#CC(C)(C)O)c4)c3)s2)CC1 |
| InChI | InChI=1S/C25H29N5O2S/c1-25(2,31)8-4-20-12-17(5-9-27-20)16-32-21-13-19(14-28-23(21)26)22-15-29-24(33-22)18-6-10-30(3)11-7-18/h5,9,12-15,18,31H,6-7,10-11,16H2,1-3H3,(H2,26,28) |
| InChIKey | GCDFTTVMLJYJJZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|