About sulfane;trimethylazanium;hydroxide
sulfane;trimethylazanium;hydroxide (PubChem CID 158376156) has the molecular formula C3H13NOS
and a molecular weight of 111.21 g/mol. Its IUPAC name is sulfane;trimethylazanium;hydroxide.
Molecular Properties
| Compound Name | sulfane;trimethylazanium;hydroxide |
| PubChem CID | 158376156 |
| Molecular Formula | C3H13NOS |
| Molecular Weight | 111.21 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | sulfane;trimethylazanium;hydroxide |
| SMILES | C[NH+](C)C.S.[OH-] |
| InChI | InChI=1S/C3H9N.H2O.H2S/c1-4(2)3;;/h1-3H3;2*1H2 |
| InChIKey | DLKFRKCTLPDFIX-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 34.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.21 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sulfane;trimethylazanium;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;trimethylazanium;hydroxide?
The IUPAC name of sulfane;trimethylazanium;hydroxide (CID 158376156) is sulfane;trimethylazanium;hydroxide.
What is the SMILES notation for sulfane;trimethylazanium;hydroxide?
The canonical SMILES for sulfane;trimethylazanium;hydroxide is C[NH+](C)C.S.[OH-].
What is the InChIKey of sulfane;trimethylazanium;hydroxide?
The InChIKey is DLKFRKCTLPDFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.H2O.H2S/c1-4(2)3;;/h1-3H3;2*1H2.
What are the key properties of sulfane;trimethylazanium;hydroxide?
sulfane;trimethylazanium;hydroxide has a molecular weight of 111.21 g/mol, XLogP of -1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;trimethylazanium;hydroxide is sourced from PubChem (CID 158376156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).