C29H62N4+2 — CID 158376537
1,6-ditert-butyl-4,4,9,9-tetrakis(2-methylpropyl)-1,6-diaza-4,9-diazoniaspiro[4.4]nonane (PubChem CID 158376537) has the molecular formula C29H62N4+2 and a molecular weight of 466.84 g/mol. Its IUPAC name is 1,6-ditert-butyl-4,4,9,9-tetrakis(2-methylpropyl)-1,6-diaza-4,9-diazoniaspiro[4.4]nonane.
| Compound Name | 1,6-ditert-butyl-4,4,9,9-tetrakis(2-methylpropyl)-1,6-diaza-4,9-diazoniaspiro[4.4]nonane |
|---|---|
| PubChem CID | 158376537 |
| Molecular Formula | C29H62N4+2 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.50 |
| IUPAC Name | 1,6-ditert-butyl-4,4,9,9-tetrakis(2-methylpropyl)-1,6-diaza-4,9-diazoniaspiro[4.4]nonane |
| SMILES | CC(C)C[N+]1(CC(C)C)CCN(C(C)(C)C)C12N(C(C)(C)C)CC[N+]2(CC(C)C)CC(C)C |
| InChI | InChI=1S/C29H62N4/c1-23(2)19-32(20-24(3)4)17-15-30(27(9,10)11)29(32)31(28(12,13)14)16-18-33(29,21-25(5)6)22-26(7)8/h23-26H,15-22H2,1-14H3/q+2 |
| InChIKey | MAWYBVZZRGBWGQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|