About 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine
2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine (PubChem CID 158376549) has the molecular formula C12H8Cl2FN3
and a molecular weight of 284.12 g/mol. Its IUPAC name is 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine.
Molecular Properties
| Compound Name | 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine |
| PubChem CID | 158376549 |
| Molecular Formula | C12H8Cl2FN3 |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine |
| SMILES | CNc1cc(F)cc2c1Cc1nc(Cl)nc(Cl)c1-2 |
| InChI | InChI=1S/C12H8Cl2FN3/c1-16-8-3-5(15)2-7-6(8)4-9-10(7)11(13)18-12(14)17-9/h2-3,16H,4H2,1H3 |
| InChIKey | MUWFQBZIVWWDHB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine?
The IUPAC name of 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine (CID 158376549) is 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine.
What is the SMILES notation for 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine?
The canonical SMILES for 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine is CNc1cc(F)cc2c1Cc1nc(Cl)nc(Cl)c1-2.
What is the InChIKey of 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine?
The InChIKey is MUWFQBZIVWWDHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2FN3/c1-16-8-3-5(15)2-7-6(8)4-9-10(7)11(13)18-12(14)17-9/h2-3,16H,4H2,1H3.
What are the key properties of 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine?
2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine has a molecular weight of 284.12 g/mol, XLogP of 3.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-fluoro-N-methyl-9H-indeno[2,1-d]pyrimidin-8-amine is sourced from PubChem (CID 158376549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).