About (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine
(2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine (PubChem CID 158378174) has the molecular formula C22H28F2N2O2
and a molecular weight of 390.47 g/mol. Its IUPAC name is (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine.
Molecular Properties
| Compound Name | (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine |
| PubChem CID | 158378174 |
| Molecular Formula | C22H28F2N2O2 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine |
| SMILES | C[C@H]1COC(c2ccc(F)cc2)CN1.C[C@H]1CO[C@H](c2ccc(F)cc2)CN1 |
| InChI | InChI=1S/2C11H14FNO/c2*1-8-7-14-11(6-13-8)9-2-4-10(12)5-3-9/h2*2-5,8,11,13H,6-7H2,1H3/t8-,11?;8-,11-/m00/s1 |
| InChIKey | GVLPFVMHWRRTDG-PXLQYMHHSA-N |
| XLogP | 3.75 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine?
The IUPAC name of (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine (CID 158378174) is (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine.
What is the SMILES notation for (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine?
The canonical SMILES for (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine is C[C@H]1COC(c2ccc(F)cc2)CN1.C[C@H]1CO[C@H](c2ccc(F)cc2)CN1.
What is the InChIKey of (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine?
The InChIKey is GVLPFVMHWRRTDG-PXLQYMHHSA-N. The full InChI is InChI=1S/2C11H14FNO/c2*1-8-7-14-11(6-13-8)9-2-4-10(12)5-3-9/h2*2-5,8,11,13H,6-7H2,1H3/t8-,11?;8-,11-/m00/s1.
What are the key properties of (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine?
(2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine has a molecular weight of 390.47 g/mol, XLogP of 3.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2-(4-fluorophenyl)-5-methylmorpholine;(5S)-2-(4-fluorophenyl)-5-methylmorpholine is sourced from PubChem (CID 158378174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).