C20H20F2N4O — CID 158378532
5-(cyclohexylmethoxy)-4-[1-(2,6-difluorophenyl)pyrazol-4-yl]pyrimidine (PubChem CID 158378532) has the molecular formula C20H20F2N4O and a molecular weight of 370.40 g/mol. Its IUPAC name is 5-(cyclohexylmethoxy)-4-[1-(2,6-difluorophenyl)pyrazol-4-yl]pyrimidine.
| Compound Name | 5-(cyclohexylmethoxy)-4-[1-(2,6-difluorophenyl)pyrazol-4-yl]pyrimidine |
|---|---|
| PubChem CID | 158378532 |
| Molecular Formula | C20H20F2N4O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 5-(cyclohexylmethoxy)-4-[1-(2,6-difluorophenyl)pyrazol-4-yl]pyrimidine |
| SMILES | Fc1cccc(F)c1-n1cc(-c2ncncc2OCC2CCCCC2)cn1 |
| InChI | InChI=1S/C20H20F2N4O/c21-16-7-4-8-17(22)20(16)26-11-15(9-25-26)19-18(10-23-13-24-19)27-12-14-5-2-1-3-6-14/h4,7-11,13-14H,1-3,5-6,12H2 |
| InChIKey | HVMJGFCTONCAKZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |