C22H28F3N5O — CID 15838017
2-[4-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline (PubChem CID 15838017) has the molecular formula C22H28F3N5O and a molecular weight of 435.49 g/mol. Its IUPAC name is 2-[4-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline.
| Compound Name | 2-[4-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 15838017 |
| Molecular Formula | C22H28F3N5O |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-[4-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline |
| SMILES | FC(F)(F)c1cccnc1N1CCN(CCCCOc2cnc3c(n2)CCCC3)CC1 |
| InChI | InChI=1S/C22H28F3N5O/c23-22(24,25)17-6-5-9-26-21(17)30-13-11-29(12-14-30)10-3-4-15-31-20-16-27-18-7-1-2-8-19(18)28-20/h5-6,9,16H,1-4,7-8,10-15H2 |
| InChIKey | VVRYUABRYGKXOM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|