C15H16O3 — CID 15838082
2,2,10-trimethyl-3,4-dihydropyrano[3,2-c]chromen-5-one (PubChem CID 15838082) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2,2,10-trimethyl-3,4-dihydropyrano[3,2-c]chromen-5-one.
| Compound Name | 2,2,10-trimethyl-3,4-dihydropyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 15838082 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2,2,10-trimethyl-3,4-dihydropyrano[3,2-c]chromen-5-one |
| SMILES | Cc1cccc2oc(=O)c3c(c12)OC(C)(C)CC3 |
| InChI | InChI=1S/C15H16O3/c1-9-5-4-6-11-12(9)13-10(14(16)17-11)7-8-15(2,3)18-13/h4-6H,7-8H2,1-3H3 |
| InChIKey | IWRBSPVHSCTEFR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|