About 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol
3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol (PubChem CID 158382000) has the molecular formula C12H32O8SSi2
and a molecular weight of 392.62 g/mol. Its IUPAC name is 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol.
Molecular Properties
| Compound Name | 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol |
| PubChem CID | 158382000 |
| Molecular Formula | C12H32O8SSi2 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol |
| SMILES | CO.CO[SiH](CCCS(=O)(=O)CCC[Si](OC)(OC)OC)OC |
| InChI | InChI=1S/C11H28O7SSi2.CH4O/c1-14-20(15-2)10-6-8-19(12,13)9-7-11-21(16-3,17-4)18-5;1-2/h20H,6-11H2,1-5H3;2H,1H3 |
| InChIKey | GVXHYTLSAQGVCC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol?
The IUPAC name of 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol (CID 158382000) is 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol.
What is the SMILES notation for 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol?
The canonical SMILES for 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol is CO.CO[SiH](CCCS(=O)(=O)CCC[Si](OC)(OC)OC)OC.
What is the InChIKey of 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol?
The InChIKey is GVXHYTLSAQGVCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H28O7SSi2.CH4O/c1-14-20(15-2)10-6-8-19(12,13)9-7-11-21(16-3,17-4)18-5;1-2/h20H,6-11H2,1-5H3;2H,1H3.
What are the key properties of 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol?
3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol has a molecular weight of 392.62 g/mol, XLogP of 0.18, 13 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-dimethoxysilylpropylsulfonyl)propyl-trimethoxysilane;methanol is sourced from PubChem (CID 158382000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).