C17H21N5O3S2 — CID 158382016
N-[2-[(4aR,6S,8aR)-2-amino-4a,6-dimethyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 158382016) has the molecular formula C17H21N5O3S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[2-[(4aR,6S,8aR)-2-amino-4a,6-dimethyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-[(4aR,6S,8aR)-2-amino-4a,6-dimethyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 158382016 |
| Molecular Formula | C17H21N5O3S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[2-[(4aR,6S,8aR)-2-amino-4a,6-dimethyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2csc([C@]34CO[C@@H](C)C[C@@]3(C)CSC(N)=N4)n2)no1 |
| InChI | InChI=1S/C17H21N5O3S2/c1-9-4-11(22-25-9)13(23)19-12-6-26-14(20-12)17-7-24-10(2)5-16(17,3)8-27-15(18)21-17/h4,6,10H,5,7-8H2,1-3H3,(H2,18,21)(H,19,23)/t10-,16-,17+/m0/s1 |
| InChIKey | GVXIVTXQHQBVBB-PZDALLCQSA-N |
| XLogP | 2.76 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |