C28H25F6N5O3S — CID 158382424
6-[4-[methylidene-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]phenyl]-2-(4-morpholin-2-ylanilino)-8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 158382424) has the molecular formula C28H25F6N5O3S and a molecular weight of 625.60 g/mol. Its IUPAC name is 6-[4-[methylidene-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]phenyl]-2-(4-morpholin-2-ylanilino)-8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-[4-[methylidene-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]phenyl]-2-(4-morpholin-2-ylanilino)-8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 158382424 |
| Molecular Formula | C28H25F6N5O3S |
| Molecular Weight | 625.60 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | 6-[4-[methylidene-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]phenyl]-2-(4-morpholin-2-ylanilino)-8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=S(=O)(CC(F)(F)F)c1ccc(-c2cc3cnc(Nc4ccc(C5CNCCO5)cc4)nc3n(CC(F)(F)F)c2=O)cc1 |
| InChI | InChI=1S/C28H25F6N5O3S/c1-43(41,16-28(32,33)34)21-8-4-17(5-9-21)22-12-19-13-36-26(38-24(19)39(25(22)40)15-27(29,30)31)37-20-6-2-18(3-7-20)23-14-35-10-11-42-23/h2-9,12-13,23,35H,1,10-11,14-16H2,(H,36,37,38) |
| InChIKey | GRUZKBKNAKMUQA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|