C21H30N2O6 — CID 158383536
(2R,5S)-2-methyl-5-[[9-(2-methylidene-5-oxopyrrol-1-yl)-6-oxononanoyl]amino]-4-oxohexanoic acid (PubChem CID 158383536) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is (2R,5S)-2-methyl-5-[[9-(2-methylidene-5-oxopyrrol-1-yl)-6-oxononanoyl]amino]-4-oxohexanoic acid.
| Compound Name | (2R,5S)-2-methyl-5-[[9-(2-methylidene-5-oxopyrrol-1-yl)-6-oxononanoyl]amino]-4-oxohexanoic acid |
|---|---|
| PubChem CID | 158383536 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (2R,5S)-2-methyl-5-[[9-(2-methylidene-5-oxopyrrol-1-yl)-6-oxononanoyl]amino]-4-oxohexanoic acid |
| SMILES | C=C1C=CC(=O)N1CCCC(=O)CCCCC(=O)N[C@@H](C)C(=O)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C21H30N2O6/c1-14(21(28)29)13-18(25)16(3)22-19(26)9-5-4-7-17(24)8-6-12-23-15(2)10-11-20(23)27/h10-11,14,16H,2,4-9,12-13H2,1,3H3,(H,22,26)(H,28,29)/t14-,16+/m1/s1 |
| InChIKey | GWBZSIYRHRGJIL-ZBFHGGJFSA-N |
| XLogP | 1.99 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|