About bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc
bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc (PubChem CID 158383757) has the molecular formula C22H30N2O8Zn
and a molecular weight of 515.88 g/mol. Its IUPAC name is bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc.
Molecular Properties
| Compound Name | bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc |
| PubChem CID | 158383757 |
| Molecular Formula | C22H30N2O8Zn |
| Molecular Weight | 515.88 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc |
| SMILES | CC1=CC(=O)N(CCCCCC(=O)O)C1=O.CC1=CC(=O)N(CCCCCC(=O)O)C1=O.[Zn] |
| InChI | InChI=1S/2C11H15NO4.Zn/c2*1-8-7-9(13)12(11(8)16)6-4-2-3-5-10(14)15;/h2*7H,2-6H2,1H3,(H,14,15); |
| InChIKey | GWCQNPSCVHQTKS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.88 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc?
The IUPAC name of bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc (CID 158383757) is bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc.
What is the SMILES notation for bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc?
The canonical SMILES for bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc is CC1=CC(=O)N(CCCCCC(=O)O)C1=O.CC1=CC(=O)N(CCCCCC(=O)O)C1=O.[Zn].
What is the InChIKey of bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc?
The InChIKey is GWCQNPSCVHQTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H15NO4.Zn/c2*1-8-7-9(13)12(11(8)16)6-4-2-3-5-10(14)15;/h2*7H,2-6H2,1H3,(H,14,15);.
What are the key properties of bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc?
bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc has a molecular weight of 515.88 g/mol, XLogP of 1.89, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-(3-methyl-2,5-dioxopyrrol-1-yl)hexanoic acid);zinc is sourced from PubChem (CID 158383757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).