C11H19Zr- — CID 158383790
carbanide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;zirconium (PubChem CID 158383790) has the molecular formula C11H19Zr- and a molecular weight of 242.50 g/mol. Its IUPAC name is carbanide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;zirconium.
| Compound Name | carbanide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;zirconium |
|---|---|
| PubChem CID | 158383790 |
| Molecular Formula | C11H19Zr- |
| Molecular Weight | 242.50 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | carbanide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;zirconium |
| SMILES | CC1=C(C)C(C)C(C)=C1C.[CH3-].[Zr] |
| InChI | InChI=1S/C10H16.CH3.Zr/c1-6-7(2)9(4)10(5)8(6)3;;/h6H,1-5H3;1H3;/q;-1; |
| InChIKey | RZWOXDLGGZVYJE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|