C26H36O4Si — CID 158384116
2-[(3aR,5R,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 158384116) has the molecular formula C26H36O4Si and a molecular weight of 440.66 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(3aR,5R,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 158384116 |
| Molecular Formula | C26H36O4Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2-[(3aR,5R,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | C[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36O4Si/c1-19-22(28-24-23(19)29-26(5,6)30-24)17-18-27-31(25(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19,22-24H,17-18H2,1-6H3/t19-,22-,23-,24-/m1/s1 |
| InChIKey | PFBPANUQVHWYLE-OTUUDDROSA-N |
| XLogP | 4.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|