C36H44BN7O6 — CID 158384310
3-[4-[[[2-[(4-aminocyclohexyl)amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenyl]benzoic acid;3-boronobenzoic acid;methane (PubChem CID 158384310) has the molecular formula C36H44BN7O6 and a molecular weight of 681.60 g/mol. Its IUPAC name is 3-[4-[[[2-[(4-aminocyclohexyl)amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenyl]benzoic acid;3-boronobenzoic acid;methane.
| Compound Name | 3-[4-[[[2-[(4-aminocyclohexyl)amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenyl]benzoic acid;3-boronobenzoic acid;methane |
|---|---|
| PubChem CID | 158384310 |
| Molecular Formula | C36H44BN7O6 |
| Molecular Weight | 681.60 g/mol |
| Exact Mass | 681.34 |
| IUPAC Name | 3-[4-[[[2-[(4-aminocyclohexyl)amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenyl]benzoic acid;3-boronobenzoic acid;methane |
| SMILES | C.CC(C)n1cnc2c(NCc3ccc(-c4cccc(C(=O)O)c4)cc3)nc(NC3CCC(N)CC3)nc21.O=C(O)c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C28H33N7O2.C7H7BO4.CH4/c1-17(2)35-16-31-24-25(33-28(34-26(24)35)32-23-12-10-22(29)11-13-23)30-15-18-6-8-19(9-7-18)20-4-3-5-21(14-20)27(36)37;9-7(10)5-2-1-3-6(4-5)8(11)12;/h3-9,14,16-17,22-23H,10-13,15,29H2,1-2H3,(H,36,37)(H2,30,32,33,34);1-4,11-12H,(H,9,10);1H4 |
| InChIKey | GWELZQKRHXVSGR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 208.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|