About 4-methylpiperidine;1-methylpiperidin-4-one
4-methylpiperidine;1-methylpiperidin-4-one (PubChem CID 158384399) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 4-methylpiperidine;1-methylpiperidin-4-one.
Molecular Properties
| Compound Name | 4-methylpiperidine;1-methylpiperidin-4-one |
| PubChem CID | 158384399 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 4-methylpiperidine;1-methylpiperidin-4-one |
| SMILES | CC1CCNCC1.CN1CCC(=O)CC1 |
| InChI | InChI=1S/C6H11NO.C6H13N/c1-7-4-2-6(8)3-5-7;1-6-2-4-7-5-3-6/h2-5H2,1H3;6-7H,2-5H2,1H3 |
| InChIKey | GWESBUDAOSMGIH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylpiperidine;1-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpiperidine;1-methylpiperidin-4-one?
The IUPAC name of 4-methylpiperidine;1-methylpiperidin-4-one (CID 158384399) is 4-methylpiperidine;1-methylpiperidin-4-one.
What is the SMILES notation for 4-methylpiperidine;1-methylpiperidin-4-one?
The canonical SMILES for 4-methylpiperidine;1-methylpiperidin-4-one is CC1CCNCC1.CN1CCC(=O)CC1.
What is the InChIKey of 4-methylpiperidine;1-methylpiperidin-4-one?
The InChIKey is GWESBUDAOSMGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C6H13N/c1-7-4-2-6(8)3-5-7;1-6-2-4-7-5-3-6/h2-5H2,1H3;6-7H,2-5H2,1H3.
What are the key properties of 4-methylpiperidine;1-methylpiperidin-4-one?
4-methylpiperidine;1-methylpiperidin-4-one has a molecular weight of 212.34 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpiperidine;1-methylpiperidin-4-one is sourced from PubChem (CID 158384399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).