About N-(4-aminocyclohexyl)prop-2-enamide;sulfane
N-(4-aminocyclohexyl)prop-2-enamide;sulfane (PubChem CID 158384464) has the molecular formula C9H20N2OS2
and a molecular weight of 236.41 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)prop-2-enamide;sulfane.
Molecular Properties
| Compound Name | N-(4-aminocyclohexyl)prop-2-enamide;sulfane |
| PubChem CID | 158384464 |
| Molecular Formula | C9H20N2OS2 |
| Molecular Weight | 236.41 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-(4-aminocyclohexyl)prop-2-enamide;sulfane |
| SMILES | C=CC(=O)NC1CCC(N)CC1.S.S |
| InChI | InChI=1S/C9H16N2O.2H2S/c1-2-9(12)11-8-5-3-7(10)4-6-8;;/h2,7-8H,1,3-6,10H2,(H,11,12);2*1H2 |
| InChIKey | GWEWBUDTMJRCGT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminocyclohexyl)prop-2-enamide;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminocyclohexyl)prop-2-enamide;sulfane?
The IUPAC name of N-(4-aminocyclohexyl)prop-2-enamide;sulfane (CID 158384464) is N-(4-aminocyclohexyl)prop-2-enamide;sulfane.
What is the SMILES notation for N-(4-aminocyclohexyl)prop-2-enamide;sulfane?
The canonical SMILES for N-(4-aminocyclohexyl)prop-2-enamide;sulfane is C=CC(=O)NC1CCC(N)CC1.S.S.
What is the InChIKey of N-(4-aminocyclohexyl)prop-2-enamide;sulfane?
The InChIKey is GWEWBUDTMJRCGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O.2H2S/c1-2-9(12)11-8-5-3-7(10)4-6-8;;/h2,7-8H,1,3-6,10H2,(H,11,12);2*1H2.
What are the key properties of N-(4-aminocyclohexyl)prop-2-enamide;sulfane?
N-(4-aminocyclohexyl)prop-2-enamide;sulfane has a molecular weight of 236.41 g/mol, XLogP of 0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminocyclohexyl)prop-2-enamide;sulfane is sourced from PubChem (CID 158384464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).