C15H21O5P — CID 158384534
1-ethyl-2,3-dihydro-1λ5-phosphole 1-oxide;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 158384534) has the molecular formula C15H21O5P and a molecular weight of 312.30 g/mol. Its IUPAC name is 1-ethyl-2,3-dihydro-1λ5-phosphole 1-oxide;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-ethyl-2,3-dihydro-1λ5-phosphole 1-oxide;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 158384534 |
| Molecular Formula | C15H21O5P |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-ethyl-2,3-dihydro-1λ5-phosphole 1-oxide;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCP1(=O)C=CCC1 |
| InChI | InChI=1S/C9H10O4.C6H11OP/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-8(7)5-3-4-6-8/h2-4H,5H2,1H3,(H,10,11)(H,12,13);3,5H,2,4,6H2,1H3 |
| InChIKey | GWFAJCCGRGHRBJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|