C23H34F3N3O6 — CID 158384759
trans-ethyl (1R,2S)-2-ethenyl-1-[[(2S,4R)-4-hydroxy-1-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]octanoyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate (PubChem CID 158384759) has the molecular formula C23H34F3N3O6 and a molecular weight of 505.53 g/mol. Its IUPAC name is trans-ethyl (1R,2S)-2-ethenyl-1-[[(2S,4R)-4-hydroxy-1-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]octanoyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2S)-2-ethenyl-1-[[(2S,4R)-4-hydroxy-1-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]octanoyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 158384759 |
| Molecular Formula | C23H34F3N3O6 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | trans-ethyl (1R,2S)-2-ethenyl-1-[[(2S,4R)-4-hydroxy-1-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]octanoyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@H](CCCCCC)NC(=O)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C23H34F3N3O6/c1-4-7-8-9-10-16(27-20(33)23(24,25)26)19(32)29-13-15(30)11-17(29)18(31)28-22(12-14(22)5-2)21(34)35-6-3/h5,14-17,30H,2,4,6-13H2,1,3H3,(H,27,33)(H,28,31)/t14-,15-,16+,17+,22-/m1/s1 |
| InChIKey | GWFSDSWNYCVRBM-DBPMHTNYSA-N |
| XLogP | 1.59 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|