C12H14FNO3S — CID 158385322
[4-[(4S,5R)-4-(fluoromethyl)-2-methyl-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid (PubChem CID 158385322) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is [4-[(4S,5R)-4-(fluoromethyl)-2-methyl-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[(4S,5R)-4-(fluoromethyl)-2-methyl-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 158385322 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | [4-[(4S,5R)-4-(fluoromethyl)-2-methyl-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid |
| SMILES | CC1=N[C@H](CF)[C@@H](c2ccc(CS(=O)O)cc2)O1 |
| InChI | InChI=1S/C12H14FNO3S/c1-8-14-11(6-13)12(17-8)10-4-2-9(3-5-10)7-18(15)16/h2-5,11-12H,6-7H2,1H3,(H,15,16)/t11-,12-/m1/s1 |
| InChIKey | FBZFGQOKYFTEEB-VXGBXAGGSA-N |
| XLogP | 2.24 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|