C49H55N6O10PS2 — CID 158386217
CID 158386217 (PubChem CID 158386217) has the molecular formula C49H55N6O10PS2 and a molecular weight of 983.12 g/mol.
| Compound Name | CID 158386217 |
|---|---|
| PubChem CID | 158386217 |
| Molecular Formula | C49H55N6O10PS2 |
| Molecular Weight | 983.12 g/mol |
| Exact Mass | 982.32 |
| IUPAC Name | — |
| SMILES | C=C1C[C@H]2C=Nc3cc(O)c(CO)cc3C(=O)N2C1.C=C1C[C@H]2C=Nc3cc(OCCP(=O)(CCC)CCOc4cc5c(cc4OC)C(=O)N4CC(=C)C[C@H]4C=N5)c(CO)cc3C(=O)N2C1.S=S |
| InChI | InChI=1S/C35H41N4O7P.C14H14N2O3.S2/c1-5-8-47(43,9-6-45-31-15-29-27(13-24(31)21-40)34(41)38-19-22(2)11-25(38)17-36-29)10-7-46-33-16-30-28(14-32(33)44-4)35(42)39-20-23(3)12-26(39)18-37-30;1-8-2-10-5-15-12-4-13(18)9(7-17)3-11(12)14(19)16(10)6-8;1-2/h13-18,25-26,40H,2-3,5-12,19-21H2,1,4H3;3-5,10,17-18H,1-2,6-7H2;/t25-,26-,47?;10-;/m00./s1 |
| InChIKey | GWKDTPIVLHJJOM-LJZSGFOXSA-N |
| XLogP | 6.76 |
| TPSA | 203.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.12 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|