C21H25NO6 — CID 158387776
3-(methylcarbamoyl)-6-[2-(3-methylphenyl)acetyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-1,4-dicarboxylic acid (PubChem CID 158387776) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-(methylcarbamoyl)-6-[2-(3-methylphenyl)acetyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-1,4-dicarboxylic acid.
| Compound Name | 3-(methylcarbamoyl)-6-[2-(3-methylphenyl)acetyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 158387776 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-(methylcarbamoyl)-6-[2-(3-methylphenyl)acetyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-1,4-dicarboxylic acid |
| SMILES | CNC(=O)C1CC(C(=O)O)C2C(C(=O)Cc3cccc(C)c3)CC(C(=O)O)C12 |
| InChI | InChI=1S/C21H25NO6/c1-10-4-3-5-11(6-10)7-16(23)12-8-14(20(25)26)18-13(19(24)22-2)9-15(17(12)18)21(27)28/h3-6,12-15,17-18H,7-9H2,1-2H3,(H,22,24)(H,25,26)(H,27,28) |
| InChIKey | OMFIWIKADXJMRS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |