C32H47N3O11S2 — CID 158389036
6-(2,3-dimethyl-5-sulfoindol-3-yl)hexanoic acid;4-hydrazinylbenzenesulfonic acid;7-methyl-8-oxononanoic acid (PubChem CID 158389036) has the molecular formula C32H47N3O11S2 and a molecular weight of 713.87 g/mol. Its IUPAC name is 6-(2,3-dimethyl-5-sulfoindol-3-yl)hexanoic acid;4-hydrazinylbenzenesulfonic acid;7-methyl-8-oxononanoic acid.
| Compound Name | 6-(2,3-dimethyl-5-sulfoindol-3-yl)hexanoic acid;4-hydrazinylbenzenesulfonic acid;7-methyl-8-oxononanoic acid |
|---|---|
| PubChem CID | 158389036 |
| Molecular Formula | C32H47N3O11S2 |
| Molecular Weight | 713.87 g/mol |
| Exact Mass | 713.27 |
| IUPAC Name | 6-(2,3-dimethyl-5-sulfoindol-3-yl)hexanoic acid;4-hydrazinylbenzenesulfonic acid;7-methyl-8-oxononanoic acid |
| SMILES | CC(=O)C(C)CCCCCC(=O)O.CC1=Nc2ccc(S(=O)(=O)O)cc2C1(C)CCCCCC(=O)O.NNc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H21NO5S.C10H18O3.C6H8N2O3S/c1-11-16(2,9-5-3-4-6-15(18)19)13-10-12(23(20,21)22)7-8-14(13)17-11;1-8(9(2)11)6-4-3-5-7-10(12)13;7-8-5-1-3-6(4-2-5)12(9,10)11/h7-8,10H,3-6,9H2,1-2H3,(H,18,19)(H,20,21,22);8H,3-7H2,1-2H3,(H,12,13);1-4,8H,7H2,(H,9,10,11) |
| InChIKey | GWSILEQAQAANGM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 250.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.87 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|