C37H47F5O5S — CID 15838948
(2R,11S,12S,14S)-14-methyl-12-[4-[6-(4,4,5,5,5-pentafluoropentylsulfonyl)hexoxy]phenyl]pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-triene-7,15-diol (PubChem CID 15838948) has the molecular formula C37H47F5O5S and a molecular weight of 698.83 g/mol. Its IUPAC name is (2R,11S,12S,14S)-14-methyl-12-[4-[6-(4,4,5,5,5-pentafluoropentylsulfonyl)hexoxy]phenyl]pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-triene-7,15-diol.
| Compound Name | (2R,11S,12S,14S)-14-methyl-12-[4-[6-(4,4,5,5,5-pentafluoropentylsulfonyl)hexoxy]phenyl]pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-triene-7,15-diol |
|---|---|
| PubChem CID | 15838948 |
| Molecular Formula | C37H47F5O5S |
| Molecular Weight | 698.83 g/mol |
| Exact Mass | 698.31 |
| IUPAC Name | (2R,11S,12S,14S)-14-methyl-12-[4-[6-(4,4,5,5,5-pentafluoropentylsulfonyl)hexoxy]phenyl]pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-triene-7,15-diol |
| SMILES | C[C@]12C[C@H](c3ccc(OCCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc3)[C@@H]3c4ccc(O)cc4CC[C@H]3C13CCC2(O)CC3 |
| InChI | InChI=1S/C37H47F5O5S/c1-33-24-30(32-29-13-10-27(43)23-26(29)9-14-31(32)34(33)16-18-35(33,44)19-17-34)25-7-11-28(12-8-25)47-20-4-2-3-5-21-48(45,46)22-6-15-36(38,39)37(40,41)42/h7-8,10-13,23,30-32,43-44H,2-6,9,14-22,24H2,1H3/t30-,31-,32+,33+,34?,35?/m1/s1 |
| InChIKey | WRIZPTACWHSLAV-LGPNAYPYSA-N |
| XLogP | 8.87 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.83 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|