About 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid
2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid (PubChem CID 158390424) has the molecular formula C16H14BBr2N3O2
and a molecular weight of 450.93 g/mol. Its IUPAC name is 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid.
Molecular Properties
| Compound Name | 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid |
| PubChem CID | 158390424 |
| Molecular Formula | C16H14BBr2N3O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 448.95 |
| IUPAC Name | 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid |
| SMILES | Cc1cc(Br)ncc1Br.OB(O)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C10H9BN2O2.C6H5Br2N/c14-11(15)9-6-12-10(13-7-9)8-4-2-1-3-5-8;1-4-2-6(8)9-3-5(4)7/h1-7,14-15H;2-3H,1H3 |
| InChIKey | GWWWDAIJGIUWJK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid?
The IUPAC name of 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid (CID 158390424) is 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid.
What is the SMILES notation for 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid?
The canonical SMILES for 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid is Cc1cc(Br)ncc1Br.OB(O)c1cnc(-c2ccccc2)nc1.
What is the InChIKey of 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid?
The InChIKey is GWWWDAIJGIUWJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BN2O2.C6H5Br2N/c14-11(15)9-6-12-10(13-7-9)8-4-2-1-3-5-8;1-4-2-6(8)9-3-5(4)7/h1-7,14-15H;2-3H,1H3.
What are the key properties of 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid?
2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid has a molecular weight of 450.93 g/mol, XLogP of 2.74, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromo-4-methylpyridine;(2-phenylpyrimidin-5-yl)boronic acid is sourced from PubChem (CID 158390424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).