C33H36N2O3 — CID 158391779
1,3-dihydro-2-benzofuran;2,3-dihydro-1-benzofuran;3,4-dihydro-2H-1,4-benzoxazine;1,2,3,4-tetrahydroisoquinoline (PubChem CID 158391779) has the molecular formula C33H36N2O3 and a molecular weight of 508.66 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran;2,3-dihydro-1-benzofuran;3,4-dihydro-2H-1,4-benzoxazine;1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1,3-dihydro-2-benzofuran;2,3-dihydro-1-benzofuran;3,4-dihydro-2H-1,4-benzoxazine;1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 158391779 |
| Molecular Formula | C33H36N2O3 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 1,3-dihydro-2-benzofuran;2,3-dihydro-1-benzofuran;3,4-dihydro-2H-1,4-benzoxazine;1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CCNC2.c1ccc2c(c1)CCO2.c1ccc2c(c1)COC2.c1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C9H11N.C8H9NO.2C8H8O/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-4-8-7(3-1)9-5-6-10-8;1-2-4-8-6-9-5-7(8)3-1;1-2-4-8-7(3-1)5-6-9-8/h1-4,10H,5-7H2;1-4,9H,5-6H2;2*1-4H,5-6H2 |
| InChIKey | GXAXIWFOHXQBHR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |