C43H49Br2N3O5 — CID 158396192
2-amino-1-[1-(4-bromophenyl)cyclobutyl]ethanone;2-[1-(4-bromophenyl)cyclobutyl]-5-phenyl-1,3,4-oxadiazole;triethoxymethylbenzene (PubChem CID 158396192) has the molecular formula C43H49Br2N3O5 and a molecular weight of 847.69 g/mol. Its IUPAC name is 2-amino-1-[1-(4-bromophenyl)cyclobutyl]ethanone;2-[1-(4-bromophenyl)cyclobutyl]-5-phenyl-1,3,4-oxadiazole;triethoxymethylbenzene.
| Compound Name | 2-amino-1-[1-(4-bromophenyl)cyclobutyl]ethanone;2-[1-(4-bromophenyl)cyclobutyl]-5-phenyl-1,3,4-oxadiazole;triethoxymethylbenzene |
|---|---|
| PubChem CID | 158396192 |
| Molecular Formula | C43H49Br2N3O5 |
| Molecular Weight | 847.69 g/mol |
| Exact Mass | 845.20 |
| IUPAC Name | 2-amino-1-[1-(4-bromophenyl)cyclobutyl]ethanone;2-[1-(4-bromophenyl)cyclobutyl]-5-phenyl-1,3,4-oxadiazole;triethoxymethylbenzene |
| SMILES | Brc1ccc(C2(c3nnc(-c4ccccc4)o3)CCC2)cc1.CCOC(OCC)(OCC)c1ccccc1.NCC(=O)C1(c2ccc(Br)cc2)CCC1 |
| InChI | InChI=1S/C18H15BrN2O.C13H20O3.C12H14BrNO/c19-15-9-7-14(8-10-15)18(11-4-12-18)17-21-20-16(22-17)13-5-2-1-3-6-13;1-4-14-13(15-5-2,16-6-3)12-10-8-7-9-11-12;13-10-4-2-9(3-5-10)12(6-1-7-12)11(15)8-14/h1-3,5-10H,4,11-12H2;7-11H,4-6H2,1-3H3;2-5H,1,6-8,14H2 |
| InChIKey | GXONHJUUTXPGRW-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.69 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|