C16H38N2O — CID 158396414
(5Z)-5-ethylidene-1,3-dimethyl-2,6-dimethylidene-1,3-diazinan-4-one;methane (PubChem CID 158396414) has the molecular formula C16H38N2O and a molecular weight of 274.49 g/mol. Its IUPAC name is (5Z)-5-ethylidene-1,3-dimethyl-2,6-dimethylidene-1,3-diazinan-4-one;methane.
| Compound Name | (5Z)-5-ethylidene-1,3-dimethyl-2,6-dimethylidene-1,3-diazinan-4-one;methane |
|---|---|
| PubChem CID | 158396414 |
| Molecular Formula | C16H38N2O |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.30 |
| IUPAC Name | (5Z)-5-ethylidene-1,3-dimethyl-2,6-dimethylidene-1,3-diazinan-4-one;methane |
| SMILES | C.C.C.C.C.C.C=C1/C(=C/C)C(=O)N(C)C(=C)N1C |
| InChI | InChI=1S/C10H14N2O.6CH4/c1-6-9-7(2)11(4)8(3)12(5)10(9)13;;;;;;/h6H,2-3H2,1,4-5H3;6*1H4/b9-6-;;;;;; |
| InChIKey | GXPDWBLQJMPBOZ-GJVKVWNDSA-N |
| XLogP | 5.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|