C13H6Cl4F8 — CID 158398553
2-chloro-1,3,3,4,4,5,5,6-octafluorocyclohexene;1,2,3-trichloro-5-methylbenzene (PubChem CID 158398553) has the molecular formula C13H6Cl4F8 and a molecular weight of 455.99 g/mol. Its IUPAC name is 2-chloro-1,3,3,4,4,5,5,6-octafluorocyclohexene;1,2,3-trichloro-5-methylbenzene.
| Compound Name | 2-chloro-1,3,3,4,4,5,5,6-octafluorocyclohexene;1,2,3-trichloro-5-methylbenzene |
|---|---|
| PubChem CID | 158398553 |
| Molecular Formula | C13H6Cl4F8 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 453.91 |
| IUPAC Name | 2-chloro-1,3,3,4,4,5,5,6-octafluorocyclohexene;1,2,3-trichloro-5-methylbenzene |
| SMILES | Cc1cc(Cl)c(Cl)c(Cl)c1.FC1=C(Cl)C(F)(F)C(F)(F)C(F)(F)C1F |
| InChI | InChI=1S/C7H5Cl3.C6HClF8/c1-4-2-5(8)7(10)6(9)3-4;7-2-1(8)3(9)5(12,13)6(14,15)4(2,10)11/h2-3H,1H3;3H |
| InChIKey | GXUZEABVHJCPJJ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|