C27H43NO6S — CID 158398814
(4R,7S,8R,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[2-methyl-3-(2-methyl-1,3-thiazol-4-yl)oxiran-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione;methane (PubChem CID 158398814) has the molecular formula C27H43NO6S and a molecular weight of 509.71 g/mol. Its IUPAC name is (4R,7S,8R,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[2-methyl-3-(2-methyl-1,3-thiazol-4-yl)oxiran-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione;methane.
| Compound Name | (4R,7S,8R,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[2-methyl-3-(2-methyl-1,3-thiazol-4-yl)oxiran-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione;methane |
|---|---|
| PubChem CID | 158398814 |
| Molecular Formula | C27H43NO6S |
| Molecular Weight | 509.71 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | (4R,7S,8R,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[2-methyl-3-(2-methyl-1,3-thiazol-4-yl)oxiran-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione;methane |
| SMILES | C.Cc1nc(C2OC2(C)[C@@H]2C/C=C\CCC[C@H](C)[C@@H](O)[C@H](C)C(=O)C(C)(C)[C@H](O)CC(=O)O2)cs1 |
| InChI | InChI=1S/C26H39NO6S.CH4/c1-15-11-9-7-8-10-12-20(26(6)24(33-26)18-14-34-17(3)27-18)32-21(29)13-19(28)25(4,5)23(31)16(2)22(15)30;/h8,10,14-16,19-20,22,24,28,30H,7,9,11-13H2,1-6H3;1H4/b10-8-;/t15-,16-,19+,20-,22+,24?,26?;/m0./s1 |
| InChIKey | GXVUCFZLDAENCW-WMGXBFHSSA-N |
| XLogP | 4.94 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|