About 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide
1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide (PubChem CID 158399575) has the molecular formula C16H22N4O2S
and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide.
Molecular Properties
| Compound Name | 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide |
| PubChem CID | 158399575 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide |
| SMILES | Cc1cc2ncnc(N3CCCC(S(N)(=O)=O)CC3)c2cc1C |
| InChI | InChI=1S/C16H22N4O2S/c1-11-8-14-15(9-12(11)2)18-10-19-16(14)20-6-3-4-13(5-7-20)23(17,21)22/h8-10,13H,3-7H2,1-2H3,(H2,17,21,22) |
| InChIKey | HXNAPBYLXAVERO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide?
The IUPAC name of 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide (CID 158399575) is 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide.
What is the SMILES notation for 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide?
The canonical SMILES for 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide is Cc1cc2ncnc(N3CCCC(S(N)(=O)=O)CC3)c2cc1C.
What is the InChIKey of 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide?
The InChIKey is HXNAPBYLXAVERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O2S/c1-11-8-14-15(9-12(11)2)18-10-19-16(14)20-6-3-4-13(5-7-20)23(17,21)22/h8-10,13H,3-7H2,1-2H3,(H2,17,21,22).
What are the key properties of 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide?
1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide has a molecular weight of 334.45 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dimethylquinazolin-4-yl)azepane-4-sulfonamide is sourced from PubChem (CID 158399575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).