C27H38O6 — CID 158400904
methyl (E)-7-[4-hydroxy-5-[(2E,4E)-2-methyldodeca-2,4-dienoyl]-6-oxopyran-2-yl]oct-3-enoate (PubChem CID 158400904) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is methyl (E)-7-[4-hydroxy-5-[(2E,4E)-2-methyldodeca-2,4-dienoyl]-6-oxopyran-2-yl]oct-3-enoate.
| Compound Name | methyl (E)-7-[4-hydroxy-5-[(2E,4E)-2-methyldodeca-2,4-dienoyl]-6-oxopyran-2-yl]oct-3-enoate |
|---|---|
| PubChem CID | 158400904 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | methyl (E)-7-[4-hydroxy-5-[(2E,4E)-2-methyldodeca-2,4-dienoyl]-6-oxopyran-2-yl]oct-3-enoate |
| SMILES | CCCCCCC/C=C/C=C(\C)C(=O)c1c(O)cc(C(C)CC/C=C/CC(=O)OC)oc1=O |
| InChI | InChI=1S/C27H38O6/c1-5-6-7-8-9-10-11-13-17-21(3)26(30)25-22(28)19-23(33-27(25)31)20(2)16-14-12-15-18-24(29)32-4/h11-13,15,17,19-20,28H,5-10,14,16,18H2,1-4H3/b13-11+,15-12+,21-17+ |
| InChIKey | PFKAWUYGIKANSM-XMFZQJPUSA-N |
| XLogP | 6.39 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|