C18H38N2 — CID 158401292
methane;5-methyl-N-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-amine;1-methylpyrrolidine (PubChem CID 158401292) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is methane;5-methyl-N-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-amine;1-methylpyrrolidine.
| Compound Name | methane;5-methyl-N-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-amine;1-methylpyrrolidine |
|---|---|
| PubChem CID | 158401292 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | methane;5-methyl-N-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-amine;1-methylpyrrolidine |
| SMILES | C.CC1CC2CC(NC(C)C)CC2C1.CN1CCCC1 |
| InChI | InChI=1S/C12H23N.C5H11N.CH4/c1-8(2)13-12-6-10-4-9(3)5-11(10)7-12;1-6-4-2-3-5-6;/h8-13H,4-7H2,1-3H3;2-5H2,1H3;1H4 |
| InChIKey | GYDAZAHVRRNTHG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |