C24H20F3N5O5 — CID 15840183
ethyl 4-[[1-[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-6-yl]pyrrol-3-yl]methylcarbamoylamino]benzoate (PubChem CID 15840183) has the molecular formula C24H20F3N5O5 and a molecular weight of 515.45 g/mol. Its IUPAC name is ethyl 4-[[1-[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-6-yl]pyrrol-3-yl]methylcarbamoylamino]benzoate.
| Compound Name | ethyl 4-[[1-[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-6-yl]pyrrol-3-yl]methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 15840183 |
| Molecular Formula | C24H20F3N5O5 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | ethyl 4-[[1-[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-6-yl]pyrrol-3-yl]methylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)NCc2ccn(-c3cc4[nH]c(=O)c(=O)[nH]c4cc3C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H20F3N5O5/c1-2-37-22(35)14-3-5-15(6-4-14)29-23(36)28-11-13-7-8-32(12-13)19-10-18-17(9-16(19)24(25,26)27)30-20(33)21(34)31-18/h3-10,12H,2,11H2,1H3,(H,30,33)(H,31,34)(H2,28,29,36) |
| InChIKey | BICPPLXRHOQXDM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|