About ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol
ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol (PubChem CID 158401862) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol.
Molecular Properties
| Compound Name | ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol |
| PubChem CID | 158401862 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol |
| SMILES | CCOC(=O)COc1cccc2[nH]c(C)cc12.Cc1cc2c(O)cccc2[nH]1 |
| InChI | InChI=1S/C13H15NO3.C9H9NO/c1-3-16-13(15)8-17-12-6-4-5-11-10(12)7-9(2)14-11;1-6-5-7-8(10-6)3-2-4-9(7)11/h4-7,14H,3,8H2,1-2H3;2-5,10-11H,1H3 |
| InChIKey | GYEVSXXGNOYFNG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol?
The IUPAC name of ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol (CID 158401862) is ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol.
What is the SMILES notation for ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol?
The canonical SMILES for ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol is CCOC(=O)COc1cccc2[nH]c(C)cc12.Cc1cc2c(O)cccc2[nH]1.
What is the InChIKey of ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol?
The InChIKey is GYEVSXXGNOYFNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3.C9H9NO/c1-3-16-13(15)8-17-12-6-4-5-11-10(12)7-9(2)14-11;1-6-5-7-8(10-6)3-2-4-9(7)11/h4-7,14H,3,8H2,1-2H3;2-5,10-11H,1H3.
What are the key properties of ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol?
ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol has a molecular weight of 380.44 g/mol, XLogP of 4.60, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-methyl-1H-indol-4-yl)oxy]acetate;2-methyl-1H-indol-4-ol is sourced from PubChem (CID 158401862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).