About bis(4-ethoxybutane-1,3-dione);titanium(2+)
bis(4-ethoxybutane-1,3-dione);titanium(2+) (PubChem CID 158401883) has the molecular formula C12H18O6Ti
and a molecular weight of 306.14 g/mol. Its IUPAC name is bis(4-ethoxybutane-1,3-dione);titanium(2+).
Molecular Properties
| Compound Name | bis(4-ethoxybutane-1,3-dione);titanium(2+) |
| PubChem CID | 158401883 |
| Molecular Formula | C12H18O6Ti |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | bis(4-ethoxybutane-1,3-dione);titanium(2+) |
| SMILES | CCOCC(=O)C[C-]=O.CCOCC(=O)C[C-]=O.[Ti+2] |
| InChI | InChI=1S/2C6H9O3.Ti/c2*1-2-9-5-6(8)3-4-7;/h2*2-3,5H2,1H3;/q2*-1;+2 |
| InChIKey | ZPKCWQPPKPUMHX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(4-ethoxybutane-1,3-dione);titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-ethoxybutane-1,3-dione);titanium(2+)?
The IUPAC name of bis(4-ethoxybutane-1,3-dione);titanium(2+) (CID 158401883) is bis(4-ethoxybutane-1,3-dione);titanium(2+).
What is the SMILES notation for bis(4-ethoxybutane-1,3-dione);titanium(2+)?
The canonical SMILES for bis(4-ethoxybutane-1,3-dione);titanium(2+) is CCOCC(=O)C[C-]=O.CCOCC(=O)C[C-]=O.[Ti+2].
What is the InChIKey of bis(4-ethoxybutane-1,3-dione);titanium(2+)?
The InChIKey is ZPKCWQPPKPUMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H9O3.Ti/c2*1-2-9-5-6(8)3-4-7;/h2*2-3,5H2,1H3;/q2*-1;+2.
What are the key properties of bis(4-ethoxybutane-1,3-dione);titanium(2+)?
bis(4-ethoxybutane-1,3-dione);titanium(2+) has a molecular weight of 306.14 g/mol, XLogP of 0.18, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-ethoxybutane-1,3-dione);titanium(2+) is sourced from PubChem (CID 158401883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).