C36H42N12O5 — CID 158402532
2-[6-(4-aminophenyl)-2-morpholin-4-ylpurin-9-yl]ethanol;2-[6-(4-aminophenyl)-2-morpholin-4-ylpurin-9-yl]ethyl acetate (PubChem CID 158402532) has the molecular formula C36H42N12O5 and a molecular weight of 722.81 g/mol. Its IUPAC name is 2-[6-(4-aminophenyl)-2-morpholin-4-ylpurin-9-yl]ethanol;2-[6-(4-aminophenyl)-2-morpholin-4-ylpurin-9-yl]ethyl acetate.
| Compound Name | 2-[6-(4-aminophenyl)-2-morpholin-4-ylpurin-9-yl]ethanol;2-[6-(4-aminophenyl)-2-morpholin-4-ylpurin-9-yl]ethyl acetate |
|---|---|
| PubChem CID | 158402532 |
| Molecular Formula | C36H42N12O5 |
| Molecular Weight | 722.81 g/mol |
| Exact Mass | 722.34 |
| IUPAC Name | 2-[6-(4-aminophenyl)-2-morpholin-4-ylpurin-9-yl]ethanol;2-[6-(4-aminophenyl)-2-morpholin-4-ylpurin-9-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1cnc2c(-c3ccc(N)cc3)nc(N3CCOCC3)nc21.Nc1ccc(-c2nc(N3CCOCC3)nc3c2ncn3CCO)cc1 |
| InChI | InChI=1S/C19H22N6O3.C17H20N6O2/c1-13(26)28-11-8-25-12-21-17-16(14-2-4-15(20)5-3-14)22-19(23-18(17)25)24-6-9-27-10-7-24;18-13-3-1-12(2-4-13)14-15-16(23(5-8-24)11-19-15)21-17(20-14)22-6-9-25-10-7-22/h2-5,12H,6-11,20H2,1H3;1-4,11,24H,5-10,18H2 |
| InChIKey | GYGYAUXHOLKBIT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 210.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|