About 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine
1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine (PubChem CID 158402630) has the molecular formula C6H10F8N2
and a molecular weight of 262.14 g/mol. Its IUPAC name is 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine.
Molecular Properties
| Compound Name | 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine |
| PubChem CID | 158402630 |
| Molecular Formula | C6H10F8N2 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine |
| SMILES | CN(C(F)(F)F)C(F)(F)F.CN(CF)CF |
| InChI | InChI=1S/C3H3F6N.C3H7F2N/c1-10(2(4,5)6)3(7,8)9;1-6(2-4)3-5/h1H3;2-3H2,1H3 |
| InChIKey | GYHFRPZBGCLOAQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine?
The IUPAC name of 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine (CID 158402630) is 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine.
What is the SMILES notation for 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine?
The canonical SMILES for 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine is CN(C(F)(F)F)C(F)(F)F.CN(CF)CF.
What is the InChIKey of 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine?
The InChIKey is GYHFRPZBGCLOAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3F6N.C3H7F2N/c1-10(2(4,5)6)3(7,8)9;1-6(2-4)3-5/h1H3;2-3H2,1H3.
What are the key properties of 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine?
1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine has a molecular weight of 262.14 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-N-(fluoromethyl)-N-methylmethanamine;1,1,1-trifluoro-N-methyl-N-(trifluoromethyl)methanamine is sourced from PubChem (CID 158402630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).