C24H29Cl2N3O2S2 — CID 158403203
1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]propan-2-one (PubChem CID 158403203) has the molecular formula C24H29Cl2N3O2S2 and a molecular weight of 526.56 g/mol. Its IUPAC name is 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]propan-2-one.
| Compound Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]propan-2-one |
|---|---|
| PubChem CID | 158403203 |
| Molecular Formula | C24H29Cl2N3O2S2 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]propan-2-one |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(CC(=O)Cc3ccc(N(CCCl)CCCl)cc3)s2)o1 |
| InChI | InChI=1S/C24H29Cl2N3O2S2/c1-24(2,3)20-14-27-21(31-20)16-32-23-15-28-22(33-23)13-19(30)12-17-4-6-18(7-5-17)29(10-8-25)11-9-26/h4-7,14-15H,8-13,16H2,1-3H3 |
| InChIKey | GYIXHSVXEWAUGS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|