C13H12O5S — CID 15840399
5-[(3,4-dihydroxyphenyl)sulfanylmethyl]benzene-1,2,3-triol (PubChem CID 15840399) has the molecular formula C13H12O5S and a molecular weight of 280.30 g/mol. Its IUPAC name is 5-[(3,4-dihydroxyphenyl)sulfanylmethyl]benzene-1,2,3-triol.
| Compound Name | 5-[(3,4-dihydroxyphenyl)sulfanylmethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 15840399 |
| Molecular Formula | C13H12O5S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 5-[(3,4-dihydroxyphenyl)sulfanylmethyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(SCc2cc(O)c(O)c(O)c2)cc1O |
| InChI | InChI=1S/C13H12O5S/c14-9-2-1-8(5-10(9)15)19-6-7-3-11(16)13(18)12(17)4-7/h1-5,14-18H,6H2 |
| InChIKey | GQWVOCGQQDBGGQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|