C35H58Br3NO13 — CID 158404673
tert-butyl (3R)-4-[2-[2-[5-[3-(2-bromo-2-methylpropanoyl)oxy-2,2-bis[(2-bromo-2-methylpropanoyl)oxymethyl]propoxy]-4-oxopentoxy]ethoxy]ethylamino]-3-methyl-4-oxobutanoate (PubChem CID 158404673) has the molecular formula C35H58Br3NO13 and a molecular weight of 940.55 g/mol. Its IUPAC name is tert-butyl (3R)-4-[2-[2-[5-[3-(2-bromo-2-methylpropanoyl)oxy-2,2-bis[(2-bromo-2-methylpropanoyl)oxymethyl]propoxy]-4-oxopentoxy]ethoxy]ethylamino]-3-methyl-4-oxobutanoate.
| Compound Name | tert-butyl (3R)-4-[2-[2-[5-[3-(2-bromo-2-methylpropanoyl)oxy-2,2-bis[(2-bromo-2-methylpropanoyl)oxymethyl]propoxy]-4-oxopentoxy]ethoxy]ethylamino]-3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 158404673 |
| Molecular Formula | C35H58Br3NO13 |
| Molecular Weight | 940.55 g/mol |
| Exact Mass | 937.15 |
| IUPAC Name | tert-butyl (3R)-4-[2-[2-[5-[3-(2-bromo-2-methylpropanoyl)oxy-2,2-bis[(2-bromo-2-methylpropanoyl)oxymethyl]propoxy]-4-oxopentoxy]ethoxy]ethylamino]-3-methyl-4-oxobutanoate |
| SMILES | C[C@H](CC(=O)OC(C)(C)C)C(=O)NCCOCCOCCCC(=O)COCC(COC(=O)C(C)(C)Br)(COC(=O)C(C)(C)Br)COC(=O)C(C)(C)Br |
| InChI | InChI=1S/C35H58Br3NO13/c1-24(18-26(41)52-31(2,3)4)27(42)39-13-15-47-17-16-46-14-11-12-25(40)19-48-20-35(21-49-28(43)32(5,6)36,22-50-29(44)33(7,8)37)23-51-30(45)34(9,10)38/h24H,11-23H2,1-10H3,(H,39,42)/t24-/m1/s1 |
| InChIKey | GYNKSOBJNSFUGQ-XMMPIXPASA-N |
| XLogP | 5.01 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|