About 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium
3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium (PubChem CID 15840500) has the molecular formula C11H13FN3O+
and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium.
Molecular Properties
| Compound Name | 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium |
| PubChem CID | 15840500 |
| Molecular Formula | C11H13FN3O+ |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium |
| SMILES | COc1c(F)cccc1-c1nn(C)c[n+]1C |
| InChI | InChI=1S/C11H13FN3O/c1-14-7-15(2)13-11(14)8-5-4-6-9(12)10(8)16-3/h4-7H,1-3H3/q+1 |
| InChIKey | WSDFTVYEMGVNTC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium?
The IUPAC name of 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium (CID 15840500) is 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium.
What is the SMILES notation for 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium?
The canonical SMILES for 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium is COc1c(F)cccc1-c1nn(C)c[n+]1C.
What is the InChIKey of 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium?
The InChIKey is WSDFTVYEMGVNTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN3O/c1-14-7-15(2)13-11(14)8-5-4-6-9(12)10(8)16-3/h4-7H,1-3H3/q+1.
What are the key properties of 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium?
3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium has a molecular weight of 222.24 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluoro-2-methoxyphenyl)-1,4-dimethyl-1,2,4-triazol-4-ium is sourced from PubChem (CID 15840500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).