About carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole]
carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole] (PubChem CID 158405402) has the molecular formula C18H23S4+
and a molecular weight of 367.65 g/mol. Its IUPAC name is carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole].
Molecular Properties
| Compound Name | carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole] |
| PubChem CID | 158405402 |
| Molecular Formula | C18H23S4+ |
| Molecular Weight | 367.65 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole] |
| SMILES | CC.CC.[CH3+].c1ccc2c(c1)SC1(S2)Sc2ccccc2S1 |
| InChI | InChI=1S/C13H8S4.2C2H6.CH3/c1-2-6-10-9(5-1)14-13(15-10)16-11-7-3-4-8-12(11)17-13;2*1-2;/h1-8H;2*1-2H3;1H3/q;;;+1 |
| InChIKey | GYPYGUMMALOTMY-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.65 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole]?
The IUPAC name of carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole] (CID 158405402) is carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole].
What is the SMILES notation for carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole]?
The canonical SMILES for carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole] is CC.CC.[CH3+].c1ccc2c(c1)SC1(S2)Sc2ccccc2S1.
What is the InChIKey of carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole]?
The InChIKey is GYPYGUMMALOTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8S4.2C2H6.CH3/c1-2-6-10-9(5-1)14-13(15-10)16-11-7-3-4-8-12(11)17-13;2*1-2;/h1-8H;2*1-2H3;1H3/q;;;+1.
What are the key properties of carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole]?
carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole] has a molecular weight of 367.65 g/mol, XLogP of 7.90, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbanylium;ethane;2,2'-spirobi[1,3-benzodithiole] is sourced from PubChem (CID 158405402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).